C18H18FN5O3 — CID 118292951
[2-[2-[[5-(6-fluoro-1H-indol-3-yl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]carbamic acid (PubChem CID 118292951) has the molecular formula C18H18FN5O3 and a molecular weight of 371.37 g/mol. Its IUPAC name is [2-[2-[[5-(6-fluoro-1H-indol-3-yl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]carbamic acid.
| Compound Name | [2-[2-[[5-(6-fluoro-1H-indol-3-yl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 118292951 |
| Molecular Formula | C18H18FN5O3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [2-[2-[[5-(6-fluoro-1H-indol-3-yl)-2-pyridinyl]amino]ethylamino]-2-oxoethyl]carbamic acid |
| SMILES | O=C(O)NCC(=O)NCCNc1ccc(-c2c[nH]c3cc(F)ccc23)cn1 |
| InChI | InChI=1S/C18H18FN5O3/c19-12-2-3-13-14(9-22-15(13)7-12)11-1-4-16(23-8-11)20-5-6-21-17(25)10-24-18(26)27/h1-4,7-9,22,24H,5-6,10H2,(H,20,23)(H,21,25)(H,26,27) |
| InChIKey | GJYUFTLQWBLXNP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|