C18H14FN5O3 — CID 118400715
1-carbamoyl-3-[[6-(6-fluoro-1H-indol-3-yl)-1,3-benzoxazol-2-yl]methyl]urea (PubChem CID 118400715) has the molecular formula C18H14FN5O3 and a molecular weight of 367.34 g/mol. Its IUPAC name is 1-carbamoyl-3-[[6-(6-fluoro-1H-indol-3-yl)-1,3-benzoxazol-2-yl]methyl]urea.
| Compound Name | 1-carbamoyl-3-[[6-(6-fluoro-1H-indol-3-yl)-1,3-benzoxazol-2-yl]methyl]urea |
|---|---|
| PubChem CID | 118400715 |
| Molecular Formula | C18H14FN5O3 |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-carbamoyl-3-[[6-(6-fluoro-1H-indol-3-yl)-1,3-benzoxazol-2-yl]methyl]urea |
| SMILES | NC(=O)NC(=O)NCc1nc2ccc(-c3c[nH]c4cc(F)ccc34)cc2o1 |
| InChI | InChI=1S/C18H14FN5O3/c19-10-2-3-11-12(7-21-14(11)6-10)9-1-4-13-15(5-9)27-16(23-13)8-22-18(26)24-17(20)25/h1-7,21H,8H2,(H4,20,22,24,25,26) |
| InChIKey | NVVGQLXZUVOMMI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |