About 5,7-diformyloxynonan-3-yl formate
5,7-diformyloxynonan-3-yl formate (PubChem CID 118296602) has the molecular formula C12H20O6
and a molecular weight of 260.29 g/mol. Its IUPAC name is 5,7-diformyloxynonan-3-yl formate.
Molecular Properties
| Compound Name | 5,7-diformyloxynonan-3-yl formate |
| PubChem CID | 118296602 |
| Molecular Formula | C12H20O6 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5,7-diformyloxynonan-3-yl formate |
| SMILES | CCC(CC(CC(CC)OC=O)OC=O)OC=O |
| InChI | InChI=1S/C12H20O6/c1-3-10(16-7-13)5-12(18-9-15)6-11(4-2)17-8-14/h7-12H,3-6H2,1-2H3 |
| InChIKey | JSWSSFKTOTZVPP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,7-diformyloxynonan-3-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-diformyloxynonan-3-yl formate?
The IUPAC name of 5,7-diformyloxynonan-3-yl formate (CID 118296602) is 5,7-diformyloxynonan-3-yl formate.
What is the SMILES notation for 5,7-diformyloxynonan-3-yl formate?
The canonical SMILES for 5,7-diformyloxynonan-3-yl formate is CCC(CC(CC(CC)OC=O)OC=O)OC=O.
What is the InChIKey of 5,7-diformyloxynonan-3-yl formate?
The InChIKey is JSWSSFKTOTZVPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O6/c1-3-10(16-7-13)5-12(18-9-15)6-11(4-2)17-8-14/h7-12H,3-6H2,1-2H3.
What are the key properties of 5,7-diformyloxynonan-3-yl formate?
5,7-diformyloxynonan-3-yl formate has a molecular weight of 260.29 g/mol, XLogP of 1.21, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-diformyloxynonan-3-yl formate is sourced from PubChem (CID 118296602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).