C14H28O2 — CID 10988024
[(2R,4R,6R,8R)-4,6,8-trimethyldecan-2-yl] formate (PubChem CID 10988024) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is [(2R,4R,6R,8R)-4,6,8-trimethyldecan-2-yl] formate.
| Compound Name | [(2R,4R,6R,8R)-4,6,8-trimethyldecan-2-yl] formate |
|---|---|
| PubChem CID | 10988024 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | [(2R,4R,6R,8R)-4,6,8-trimethyldecan-2-yl] formate |
| SMILES | CC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@@H](C)OC=O |
| InChI | InChI=1S/C14H28O2/c1-6-11(2)7-12(3)8-13(4)9-14(5)16-10-15/h10-14H,6-9H2,1-5H3/t11-,12-,13-,14-/m1/s1 |
| InChIKey | DADONZZNAPBKET-AAVRWANBSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|