C8H7NO2S — CID 11830047
6-hydroxy-3-methyl-1,3-benzothiazol-2-one (PubChem CID 11830047) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 6-hydroxy-3-methyl-1,3-benzothiazol-2-one.
| Compound Name | 6-hydroxy-3-methyl-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 11830047 |
| Molecular Formula | C8H7NO2S |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 6-hydroxy-3-methyl-1,3-benzothiazol-2-one |
| SMILES | Cn1c(=O)sc2cc(O)ccc21 |
| InChI | InChI=1S/C8H7NO2S/c1-9-6-3-2-5(10)4-7(6)12-8(9)11/h2-4,10H,1H3 |
| InChIKey | OFRAGDTYBWBHTR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |