C7H5NO2S — CID 11491998
6-hydroxy-3H-1,3-benzothiazol-2-one (PubChem CID 11491998) has the molecular formula C7H5NO2S and a molecular weight of 167.19 g/mol. Its IUPAC name is 6-hydroxy-3H-1,3-benzothiazol-2-one.
| Compound Name | 6-hydroxy-3H-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 11491998 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 6-hydroxy-3H-1,3-benzothiazol-2-one |
| SMILES | O=c1[nH]c2ccc(O)cc2s1 |
| InChI | InChI=1S/C7H5NO2S/c9-4-1-2-5-6(3-4)11-7(10)8-5/h1-3,9H,(H,8,10) |
| InChIKey | IOAXKKHMBVTXJX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |