C13H23N4O4S+ — CID 118300722
[(2S)-1-[2-(2-amino-2-carboxyethyl)sulfinyl-1H-imidazol-5-yl]-3-oxobutan-2-yl]-trimethylazanium (PubChem CID 118300722) has the molecular formula C13H23N4O4S+ and a molecular weight of 331.42 g/mol. Its IUPAC name is [(2S)-1-[2-(2-amino-2-carboxyethyl)sulfinyl-1H-imidazol-5-yl]-3-oxobutan-2-yl]-trimethylazanium.
| Compound Name | [(2S)-1-[2-(2-amino-2-carboxyethyl)sulfinyl-1H-imidazol-5-yl]-3-oxobutan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 118300722 |
| Molecular Formula | C13H23N4O4S+ |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(2S)-1-[2-(2-amino-2-carboxyethyl)sulfinyl-1H-imidazol-5-yl]-3-oxobutan-2-yl]-trimethylazanium |
| SMILES | CC(=O)[C@H](Cc1cnc(S(=O)CC(N)C(=O)O)[nH]1)[N+](C)(C)C |
| InChI | InChI=1S/C13H22N4O4S/c1-8(18)11(17(2,3)4)5-9-6-15-13(16-9)22(21)7-10(14)12(19)20/h6,10-11H,5,7,14H2,1-4H3,(H-,15,16,19,20)/p+1/t10?,11-,22?/m0/s1 |
| InChIKey | OATAEJVXHJALSY-BCHUWMMESA-O |
| XLogP | -0.86 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|