C15H16BrClF2N4O3S — CID 118302048
N-(2-bromo-4-pyridinyl)-3-chloro-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 118302048) has the molecular formula C15H16BrClF2N4O3S and a molecular weight of 485.74 g/mol. Its IUPAC name is N-(2-bromo-4-pyridinyl)-3-chloro-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(2-bromo-4-pyridinyl)-3-chloro-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118302048 |
| Molecular Formula | C15H16BrClF2N4O3S |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | N-(2-bromo-4-pyridinyl)-3-chloro-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cn(C)c(C(=O)Nc2ccnc(Br)c2)c1Cl)C(C)(F)F |
| InChI | InChI=1S/C15H16BrClF2N4O3S/c1-8(15(2,18)19)22-27(25,26)10-7-23(3)13(12(10)17)14(24)21-9-4-5-20-11(16)6-9/h4-8,22H,1-3H3,(H,20,21,24)/t8-/m1/s1 |
| InChIKey | UTTSGLIFXBVWAD-MRVPVSSYSA-N |
| XLogP | 3.41 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|