C15H14ClF5N4O3S — CID 162609065
3-chloro-N-(3,4-difluorophenyl)-1-methyl-4-[(1,1,1-trifluoropropan-2-ylamino)sulfamoyl]pyrrole-2-carboxamide (PubChem CID 162609065) has the molecular formula C15H14ClF5N4O3S and a molecular weight of 460.81 g/mol. Its IUPAC name is 3-chloro-N-(3,4-difluorophenyl)-1-methyl-4-[(1,1,1-trifluoropropan-2-ylamino)sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(3,4-difluorophenyl)-1-methyl-4-[(1,1,1-trifluoropropan-2-ylamino)sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 162609065 |
| Molecular Formula | C15H14ClF5N4O3S |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 3-chloro-N-(3,4-difluorophenyl)-1-methyl-4-[(1,1,1-trifluoropropan-2-ylamino)sulfamoyl]pyrrole-2-carboxamide |
| SMILES | CC(NNS(=O)(=O)c1cn(C)c(C(=O)Nc2ccc(F)c(F)c2)c1Cl)C(F)(F)F |
| InChI | InChI=1S/C15H14ClF5N4O3S/c1-7(15(19,20)21)23-24-29(27,28)11-6-25(2)13(12(11)16)14(26)22-8-3-4-9(17)10(18)5-8/h3-7,23-24H,1-2H3,(H,22,26) |
| InChIKey | BDWYEIIHMZBKAB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 92.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|