C15H16Cl2F2N4O3S — CID 118302349
3-chloro-N-(2-chloro-4-pyridinyl)-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 118302349) has the molecular formula C15H16Cl2F2N4O3S and a molecular weight of 441.29 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-4-pyridinyl)-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(2-chloro-4-pyridinyl)-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118302349 |
| Molecular Formula | C15H16Cl2F2N4O3S |
| Molecular Weight | 441.29 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 3-chloro-N-(2-chloro-4-pyridinyl)-4-[[(2R)-3,3-difluorobutan-2-yl]sulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cn(C)c(C(=O)Nc2ccnc(Cl)c2)c1Cl)C(C)(F)F |
| InChI | InChI=1S/C15H16Cl2F2N4O3S/c1-8(15(2,18)19)22-27(25,26)10-7-23(3)13(12(10)17)14(24)21-9-4-5-20-11(16)6-9/h4-8,22H,1-3H3,(H,20,21,24)/t8-/m1/s1 |
| InChIKey | IIPHPDAQCYSTIT-MRVPVSSYSA-N |
| XLogP | 3.30 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|