C15H13Cl2F3N4OS — CID 144898818
3-chloro-N-(2-chloro-4-pyridinyl)-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]sulfanylpyrrole-2-carboxamide (PubChem CID 144898818) has the molecular formula C15H13Cl2F3N4OS and a molecular weight of 425.26 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-4-pyridinyl)-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]sulfanylpyrrole-2-carboxamide.
| Compound Name | 3-chloro-N-(2-chloro-4-pyridinyl)-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]sulfanylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 144898818 |
| Molecular Formula | C15H13Cl2F3N4OS |
| Molecular Weight | 425.26 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 3-chloro-N-(2-chloro-4-pyridinyl)-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]amino]sulfanylpyrrole-2-carboxamide |
| SMILES | Cn1cc(SNC2(C(F)(F)F)CC2)c(Cl)c1C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2F3N4OS/c1-24-7-9(26-23-14(3-4-14)15(18,19)20)11(17)12(24)13(25)22-8-2-5-21-10(16)6-8/h2,5-7,23H,3-4H2,1H3,(H,21,22,25) |
| InChIKey | SEWIOGZSYOKANY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.26 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|