C17H17ClF3IN4O2Si — CID 163487634
N-(2-chloro-4-pyridinyl)-1-methyl-3-(methylidene-λ3-iodanyl)-4-[oxo-[[1-(trifluoromethyl)cyclobutyl]amino]silyl]pyrrole-2-carboxamide (PubChem CID 163487634) has the molecular formula C17H17ClF3IN4O2Si and a molecular weight of 556.79 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-1-methyl-3-(methylidene-λ3-iodanyl)-4-[oxo-[[1-(trifluoromethyl)cyclobutyl]amino]silyl]pyrrole-2-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-1-methyl-3-(methylidene-λ3-iodanyl)-4-[oxo-[[1-(trifluoromethyl)cyclobutyl]amino]silyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 163487634 |
| Molecular Formula | C17H17ClF3IN4O2Si |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-1-methyl-3-(methylidene-λ3-iodanyl)-4-[oxo-[[1-(trifluoromethyl)cyclobutyl]amino]silyl]pyrrole-2-carboxamide |
| SMILES | C=Ic1c([Si](=O)NC2(C(F)(F)F)CCC2)cn(C)c1C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C17H17ClF3IN4O2Si/c1-22-13-11(29(28)25-16(5-3-6-16)17(19,20)21)9-26(2)14(13)15(27)24-10-4-7-23-12(18)8-10/h4,7-9,25H,1,3,5-6H2,2H3,(H,23,24,27) |
| InChIKey | CJXCIOSXYUHYHT-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|