C15H13ClF4N4O3S — CID 118302169
N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]pyrrole-2-carboxamide (PubChem CID 118302169) has the molecular formula C15H13ClF4N4O3S and a molecular weight of 440.81 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]pyrrole-2-carboxamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118302169 |
| Molecular Formula | C15H13ClF4N4O3S |
| Molecular Weight | 440.81 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-3-fluoro-1-methyl-4-[[1-(trifluoromethyl)cyclopropyl]sulfamoyl]pyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NC2(C(F)(F)F)CC2)c(F)c1C(=O)Nc1ccnc(Cl)c1 |
| InChI | InChI=1S/C15H13ClF4N4O3S/c1-24-7-9(28(26,27)23-14(3-4-14)15(18,19)20)11(17)12(24)13(25)22-8-2-5-21-10(16)6-8/h2,5-7,23H,3-4H2,1H3,(H,21,22,25) |
| InChIKey | QUOANOUVZKIQEB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|