C31H42N4O8 — CID 118305225
4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]butanoic acid;formic acid (PubChem CID 118305225) has the molecular formula C31H42N4O8 and a molecular weight of 598.70 g/mol. Its IUPAC name is 4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]butanoic acid;formic acid.
| Compound Name | 4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]butanoic acid;formic acid |
|---|---|
| PubChem CID | 118305225 |
| Molecular Formula | C31H42N4O8 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 4-[[(2S)-1,6-diamino-1-oxohexan-2-yl]-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]butanoic acid;formic acid |
| SMILES | CC(C)[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(CCCC(=O)O)[C@@H](CCCCN)C(N)=O.O=CO |
| InChI | InChI=1S/C30H40N4O6.CH2O2/c1-19(2)27(29(38)34(17-9-15-26(35)36)25(28(32)37)14-7-8-16-31)33-30(39)40-18-24-22-12-5-3-10-20(22)21-11-4-6-13-23(21)24;2-1-3/h3-6,10-13,19,24-25,27H,7-9,14-18,31H2,1-2H3,(H2,32,37)(H,33,39)(H,35,36);1H,(H,2,3)/t25-,27-;/m0./s1 |
| InChIKey | FOBILQQYNWLUCW-IFYQUOOLSA-N |
| XLogP | 2.93 |
| TPSA | 202.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|