C13H9F15OS — CID 118305384
4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-prop-2-enyldecanethioic S-acid (PubChem CID 118305384) has the molecular formula C13H9F15OS and a molecular weight of 498.25 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-prop-2-enyldecanethioic S-acid.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-prop-2-enyldecanethioic S-acid |
|---|---|
| PubChem CID | 118305384 |
| Molecular Formula | C13H9F15OS |
| Molecular Weight | 498.25 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-3-prop-2-enyldecanethioic S-acid |
| SMILES | C=CCC(CC(=O)S)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F15OS/c1-2-3-5(4-6(29)30)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h2,5H,1,3-4H2,(H,29,30) |
| InChIKey | CVOOQYKUJYBKQI-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.25 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|