C14H18FN — CID 118307040
N-[(2-but-3-enyl-4-fluorophenyl)methyl]cyclopropanamine (PubChem CID 118307040) has the molecular formula C14H18FN and a molecular weight of 219.30 g/mol. Its IUPAC name is N-[(2-but-3-enyl-4-fluorophenyl)methyl]cyclopropanamine.
| Compound Name | N-[(2-but-3-enyl-4-fluorophenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 118307040 |
| Molecular Formula | C14H18FN |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-[(2-but-3-enyl-4-fluorophenyl)methyl]cyclopropanamine |
| SMILES | C=CCCc1cc(F)ccc1CNC1CC1 |
| InChI | InChI=1S/C14H18FN/c1-2-3-4-11-9-13(15)6-5-12(11)10-16-14-7-8-14/h2,5-6,9,14,16H,1,3-4,7-8,10H2 |
| InChIKey | FVCOYCILNDHDRW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|