About 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine
5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 118308711) has the molecular formula C12H16FNO2
and a molecular weight of 225.26 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine |
| PubChem CID | 118308711 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(N)(c2ccc(F)cc2)CO1 |
| InChI | InChI=1S/C12H16FNO2/c1-11(2)15-7-12(14,8-16-11)9-3-5-10(13)6-4-9/h3-6H,7-8,14H2,1-2H3 |
| InChIKey | CBIIZVCYDZUMHD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine?
The IUPAC name of 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine (CID 118308711) is 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine.
What is the SMILES notation for 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine?
The canonical SMILES for 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine is CC1(C)OCC(N)(c2ccc(F)cc2)CO1.
What is the InChIKey of 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine?
The InChIKey is CBIIZVCYDZUMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FNO2/c1-11(2)15-7-12(14,8-16-11)9-3-5-10(13)6-4-9/h3-6H,7-8,14H2,1-2H3.
What are the key properties of 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine?
5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine has a molecular weight of 225.26 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-2,2-dimethyl-1,3-dioxan-5-amine is sourced from PubChem (CID 118308711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).