C16H17F2NO2 — CID 118309045
ethyl 5,5-difluoro-2-(2-pyridin-2-ylethynyl)cyclohexane-1-carboxylate (PubChem CID 118309045) has the molecular formula C16H17F2NO2 and a molecular weight of 293.31 g/mol. Its IUPAC name is ethyl 5,5-difluoro-2-(2-pyridin-2-ylethynyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 5,5-difluoro-2-(2-pyridin-2-ylethynyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 118309045 |
| Molecular Formula | C16H17F2NO2 |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 5,5-difluoro-2-(2-pyridin-2-ylethynyl)cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CC(F)(F)CCC1C#Cc1ccccn1 |
| InChI | InChI=1S/C16H17F2NO2/c1-2-21-15(20)14-11-16(17,18)9-8-12(14)6-7-13-5-3-4-10-19-13/h3-5,10,12,14H,2,8-9,11H2,1H3 |
| InChIKey | WLHUHGQERVHQEE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|