C11H22N2O — CID 118311285
N,N,2-trimethyl-2-piperidin-1-ylpropanamide (PubChem CID 118311285) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N,N,2-trimethyl-2-piperidin-1-ylpropanamide.
| Compound Name | N,N,2-trimethyl-2-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 118311285 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N,N,2-trimethyl-2-piperidin-1-ylpropanamide |
| SMILES | CN(C)C(=O)C(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C11H22N2O/c1-11(2,10(14)12(3)4)13-8-6-5-7-9-13/h5-9H2,1-4H3 |
| InChIKey | FKLFSFPOXZWXGC-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |