About 3-phenylselanylbutanal
3-phenylselanylbutanal (PubChem CID 11831146) has the molecular formula C10H12OSe
and a molecular weight of 227.17 g/mol. Its IUPAC name is 3-phenylselanylbutanal.
Molecular Properties
| Compound Name | 3-phenylselanylbutanal |
| PubChem CID | 11831146 |
| Molecular Formula | C10H12OSe |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 3-phenylselanylbutanal |
| SMILES | CC(CC=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C10H12OSe/c1-9(7-8-11)12-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3 |
| InChIKey | YQLYQLCFULUTIA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylselanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylselanylbutanal?
The IUPAC name of 3-phenylselanylbutanal (CID 11831146) is 3-phenylselanylbutanal.
What is the SMILES notation for 3-phenylselanylbutanal?
The canonical SMILES for 3-phenylselanylbutanal is CC(CC=O)[Se]c1ccccc1.
What is the InChIKey of 3-phenylselanylbutanal?
The InChIKey is YQLYQLCFULUTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12OSe/c1-9(7-8-11)12-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3.
What are the key properties of 3-phenylselanylbutanal?
3-phenylselanylbutanal has a molecular weight of 227.17 g/mol, XLogP of 1.41, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylselanylbutanal is sourced from PubChem (CID 11831146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).