C40H26Br2I2 — CID 118312625
5-bromo-11-(11-bromo-6-iodo-7,9-dimethylchrysen-5-yl)-12-iodo-1,3-dimethylchrysene (PubChem CID 118312625) has the molecular formula C40H26Br2I2 and a molecular weight of 920.26 g/mol. Its IUPAC name is 5-bromo-11-(11-bromo-6-iodo-7,9-dimethylchrysen-5-yl)-12-iodo-1,3-dimethylchrysene.
| Compound Name | 5-bromo-11-(11-bromo-6-iodo-7,9-dimethylchrysen-5-yl)-12-iodo-1,3-dimethylchrysene |
|---|---|
| PubChem CID | 118312625 |
| Molecular Formula | C40H26Br2I2 |
| Molecular Weight | 920.26 g/mol |
| Exact Mass | 917.85 |
| IUPAC Name | 5-bromo-11-(11-bromo-6-iodo-7,9-dimethylchrysen-5-yl)-12-iodo-1,3-dimethylchrysene |
| SMILES | Cc1cc(C)c2c(I)c(-c3c(I)c4c(C)cc(C)cc4c4c(Br)cc5ccccc5c34)c3c4ccccc4cc(Br)c3c2c1 |
| InChI | InChI=1S/C40H26Br2I2/c1-19-13-21(3)31-27(15-19)33-29(41)17-23-9-5-7-11-25(23)35(33)37(39(31)43)38-36-26-12-8-6-10-24(26)18-30(42)34(36)28-16-20(2)14-22(4)32(28)40(38)44/h5-18H,1-4H3 |
| InChIKey | DDOVWBRXCQRWMF-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 920.26 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|