C52H39N5 — CID 118321383
9-(2,6-diphenyl-4-pyridinyl)-N-(4,6-diphenylpyrimidin-2-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazol-1-amine (PubChem CID 118321383) has the molecular formula C52H39N5 and a molecular weight of 733.92 g/mol. Its IUPAC name is 9-(2,6-diphenyl-4-pyridinyl)-N-(4,6-diphenylpyrimidin-2-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazol-1-amine.
| Compound Name | 9-(2,6-diphenyl-4-pyridinyl)-N-(4,6-diphenylpyrimidin-2-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazol-1-amine |
|---|---|
| PubChem CID | 118321383 |
| Molecular Formula | C52H39N5 |
| Molecular Weight | 733.92 g/mol |
| Exact Mass | 733.32 |
| IUPAC Name | 9-(2,6-diphenyl-4-pyridinyl)-N-(4,6-diphenylpyrimidin-2-yl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]carbazol-1-amine |
| SMILES | C=C/C=C\C=C(/C)c1ccc2c3ccccc3n(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)c2c1Nc1nc(-c2ccccc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C52H39N5/c1-3-4-9-20-36(2)42-31-32-44-43-29-18-19-30-49(43)57(41-33-45(37-21-10-5-11-22-37)53-46(34-41)38-23-12-6-13-24-38)51(44)50(42)56-52-54-47(39-25-14-7-15-26-39)35-48(55-52)40-27-16-8-17-28-40/h3-35H,1H2,2H3,(H,54,55,56)/b9-4-,36-20+ |
| InChIKey | ATGUECRKILOKOP-YBMVHJMKSA-N |
| XLogP | 13.53 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.92 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|