C15H24N2O2 — CID 11832298
tert-butyl (2R)-2-[(3S)-1,2,3,6-tetrahydropyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 11832298) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(3S)-1,2,3,6-tetrahydropyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(3S)-1,2,3,6-tetrahydropyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 11832298 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | tert-butyl (2R)-2-[(3S)-1,2,3,6-tetrahydropyridin-3-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=CC[C@@H]1[C@H]1C=CCNC1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,3)19-14(18)17-10-5-4-8-13(17)12-7-6-9-16-11-12/h4-7,12-13,16H,8-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | PARKQLFCTUJOFX-QWHCGFSZSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|