C14H19NO4 — CID 11832325
methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate (PubChem CID 11832325) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate.
| Compound Name | methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11832325 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate |
| SMILES | CCO[C@@H]1C[C@@H](C(=O)OC)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H19NO4/c1-3-18-13-9-12(14(16)17-2)15(19-13)10-11-7-5-4-6-8-11/h4-8,12-13H,3,9-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | GYXASRREDSNYIW-STQMWFEESA-N |
| XLogP | 1.73 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |