methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate

C14H19NO4 — CID 11832325

IUPACmethyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate
SMILESCCO[C@@H]1C[C@@H](C(=O)OC)N(Cc2ccccc2)O1
InChIInChI=1S/C14H19NO4/c1-3-18-13-9-12(14(16)17-2)15(19-13)10-11-7-5-4-6-8-11/h4-8,12-13H,3,9-10H2,1-2H3/t12-,13-/m0/s1
InChIKeyGYXASRREDSNYIW-STQMWFEESA-N
MW265.31 g/mol
LogP1.73
Rot. Bonds5

About methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate

methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate (PubChem CID 11832325) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate.

Molecular Properties

Compound Namemethyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate
PubChem CID11832325
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Namemethyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate
SMILESCCO[C@@H]1C[C@@H](C(=O)OC)N(Cc2ccccc2)O1
InChIInChI=1S/C14H19NO4/c1-3-18-13-9-12(14(16)17-2)15(19-13)10-11-7-5-4-6-8-11/h4-8,12-13H,3,9-10H2,1-2H3/t12-,13-/m0/s1
InChIKeyGYXASRREDSNYIW-STQMWFEESA-N
XLogP1.73
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate?
The IUPAC name of methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate (CID 11832325) is methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate.
What is the SMILES notation for methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate?
The canonical SMILES for methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate is CCO[C@@H]1C[C@@H](C(=O)OC)N(Cc2ccccc2)O1.
What is the InChIKey of methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate?
The InChIKey is GYXASRREDSNYIW-STQMWFEESA-N. The full InChI is InChI=1S/C14H19NO4/c1-3-18-13-9-12(14(16)17-2)15(19-13)10-11-7-5-4-6-8-11/h4-8,12-13H,3,9-10H2,1-2H3/t12-,13-/m0/s1.
What are the key properties of methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate?
methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate has a molecular weight of 265.31 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate is sourced from PubChem (CID 11832325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).