C15H15CrNO6 — CID 134899183
carbon monoxide;chromium;[(3S,5R)-2-methyl-3-phenyl-1,2-oxazolidin-5-yl] acetate (PubChem CID 134899183) has the molecular formula C15H15CrNO6 and a molecular weight of 357.28 g/mol. Its IUPAC name is carbon monoxide;chromium;[(3S,5R)-2-methyl-3-phenyl-1,2-oxazolidin-5-yl] acetate.
| Compound Name | carbon monoxide;chromium;[(3S,5R)-2-methyl-3-phenyl-1,2-oxazolidin-5-yl] acetate |
|---|---|
| PubChem CID | 134899183 |
| Molecular Formula | C15H15CrNO6 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | carbon monoxide;chromium;[(3S,5R)-2-methyl-3-phenyl-1,2-oxazolidin-5-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](c2ccccc2)N(C)O1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C12H15NO3.3CO.Cr/c1-9(14)15-12-8-11(13(2)16-12)10-6-4-3-5-7-10;3*1-2;/h3-7,11-12H,8H2,1-2H3;;;;/t11-,12+;;;;/m0..../s1 |
| InChIKey | GYTUMDBZPOKELR-QHSFPFIWSA-N |
| XLogP | 1.77 |
| TPSA | 98.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|