C15H17CrNO5 — CID 134899175
carbon monoxide;chromium;(3S,5R)-5-ethoxy-2-methyl-3-phenyl-1,2-oxazolidine (PubChem CID 134899175) has the molecular formula C15H17CrNO5 and a molecular weight of 343.30 g/mol. Its IUPAC name is carbon monoxide;chromium;(3S,5R)-5-ethoxy-2-methyl-3-phenyl-1,2-oxazolidine.
| Compound Name | carbon monoxide;chromium;(3S,5R)-5-ethoxy-2-methyl-3-phenyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 134899175 |
| Molecular Formula | C15H17CrNO5 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | carbon monoxide;chromium;(3S,5R)-5-ethoxy-2-methyl-3-phenyl-1,2-oxazolidine |
| SMILES | CCO[C@H]1C[C@@H](c2ccccc2)N(C)O1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C12H17NO2.3CO.Cr/c1-3-14-12-9-11(13(2)15-12)10-7-5-4-6-8-10;3*1-2;/h4-8,11-12H,3,9H2,1-2H3;;;;/t11-,12+;;;;/m0..../s1 |
| InChIKey | ALMLOVDALLSXJH-QHSFPFIWSA-N |
| XLogP | 2.24 |
| TPSA | 81.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|