C11H15NO2 — CID 11041624
(3R,4S)-2,4-dimethyl-3-phenyl-1,2-oxazolidin-5-ol (PubChem CID 11041624) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3R,4S)-2,4-dimethyl-3-phenyl-1,2-oxazolidin-5-ol.
| Compound Name | (3R,4S)-2,4-dimethyl-3-phenyl-1,2-oxazolidin-5-ol |
|---|---|
| PubChem CID | 11041624 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3R,4S)-2,4-dimethyl-3-phenyl-1,2-oxazolidin-5-ol |
| SMILES | C[C@@H]1C(O)ON(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-8-10(12(2)14-11(8)13)9-6-4-3-5-7-9/h3-8,10-11,13H,1-2H3/t8-,10+,11?/m0/s1 |
| InChIKey | RIVZDFZEQICWML-OZRKRLJNSA-N |
| XLogP | 1.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |