About (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone
(1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone (PubChem CID 118326274) has the molecular formula C21H18F2N2O2
and a molecular weight of 368.38 g/mol. Its IUPAC name is (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone.
Molecular Properties
| Compound Name | (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone |
| PubChem CID | 118326274 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone |
| SMILES | CCOc1nccc2c(C(=O)c3c(F)cc4c(c3F)CCC4N)cccc12 |
| InChI | InChI=1S/C21H18F2N2O2/c1-2-27-21-14-5-3-4-13(11(14)8-9-25-21)20(26)18-16(22)10-15-12(19(18)23)6-7-17(15)24/h3-5,8-10,17H,2,6-7,24H2,1H3 |
| InChIKey | FWHJQQHZXBKTEA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone?
The IUPAC name of (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone (CID 118326274) is (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone.
What is the SMILES notation for (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone?
The canonical SMILES for (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone is CCOc1nccc2c(C(=O)c3c(F)cc4c(c3F)CCC4N)cccc12.
What is the InChIKey of (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone?
The InChIKey is FWHJQQHZXBKTEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F2N2O2/c1-2-27-21-14-5-3-4-13(11(14)8-9-25-21)20(26)18-16(22)10-15-12(19(18)23)6-7-17(15)24/h3-5,8-10,17H,2,6-7,24H2,1H3.
What are the key properties of (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone?
(1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone has a molecular weight of 368.38 g/mol, XLogP of 4.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-4,6-difluoro-2,3-dihydro-1H-inden-5-yl)-(1-ethoxyisoquinolin-5-yl)methanone is sourced from PubChem (CID 118326274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).