C23H22F2N2O4 — CID 118326230
4-[4-(1-ethoxyisoquinoline-5-carbonyl)-3,5-difluorophenyl]butylcarbamic acid (PubChem CID 118326230) has the molecular formula C23H22F2N2O4 and a molecular weight of 428.44 g/mol. Its IUPAC name is 4-[4-(1-ethoxyisoquinoline-5-carbonyl)-3,5-difluorophenyl]butylcarbamic acid.
| Compound Name | 4-[4-(1-ethoxyisoquinoline-5-carbonyl)-3,5-difluorophenyl]butylcarbamic acid |
|---|---|
| PubChem CID | 118326230 |
| Molecular Formula | C23H22F2N2O4 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 4-[4-(1-ethoxyisoquinoline-5-carbonyl)-3,5-difluorophenyl]butylcarbamic acid |
| SMILES | CCOc1nccc2c(C(=O)c3c(F)cc(CCCCNC(=O)O)cc3F)cccc12 |
| InChI | InChI=1S/C23H22F2N2O4/c1-2-31-22-17-8-5-7-16(15(17)9-11-26-22)21(28)20-18(24)12-14(13-19(20)25)6-3-4-10-27-23(29)30/h5,7-9,11-13,27H,2-4,6,10H2,1H3,(H,29,30) |
| InChIKey | WJOQFCQODOZTAA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|