C26H30N2O4 — CID 140785568
tert-butyl N-[(1S)-1-[4-(1-ethoxyisoquinoline-5-carbonyl)-3-methylphenyl]ethyl]carbamate (PubChem CID 140785568) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-(1-ethoxyisoquinoline-5-carbonyl)-3-methylphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-(1-ethoxyisoquinoline-5-carbonyl)-3-methylphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 140785568 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-(1-ethoxyisoquinoline-5-carbonyl)-3-methylphenyl]ethyl]carbamate |
| SMILES | CCOc1nccc2c(C(=O)c3ccc([C@H](C)NC(=O)OC(C)(C)C)cc3C)cccc12 |
| InChI | InChI=1S/C26H30N2O4/c1-7-31-24-22-10-8-9-21(20(22)13-14-27-24)23(29)19-12-11-18(15-16(19)2)17(3)28-25(30)32-26(4,5)6/h8-15,17H,7H2,1-6H3,(H,28,30)/t17-/m0/s1 |
| InChIKey | CYWZXTVHIXULIH-KRWDZBQOSA-N |
| XLogP | 5.76 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |