C17H26BrNO4 — CID 155595623
tert-butyl N-[(1R)-1-(4-bromo-3,5-diethoxyphenyl)ethyl]carbamate (PubChem CID 155595623) has the molecular formula C17H26BrNO4 and a molecular weight of 388.30 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(4-bromo-3,5-diethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(4-bromo-3,5-diethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 155595623 |
| Molecular Formula | C17H26BrNO4 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | tert-butyl N-[(1R)-1-(4-bromo-3,5-diethoxyphenyl)ethyl]carbamate |
| SMILES | CCOc1cc([C@@H](C)NC(=O)OC(C)(C)C)cc(OCC)c1Br |
| InChI | InChI=1S/C17H26BrNO4/c1-7-21-13-9-12(10-14(15(13)18)22-8-2)11(3)19-16(20)23-17(4,5)6/h9-11H,7-8H2,1-6H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | XWJUXCVEJCSRCN-LLVKDONJSA-N |
| XLogP | 4.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |