C16H20BrClN2O3 — CID 123418761
tert-butyl N-[1-(3-bromo-5-chloro-4-cyano-2-ethoxyphenyl)ethyl]carbamate (PubChem CID 123418761) has the molecular formula C16H20BrClN2O3 and a molecular weight of 403.70 g/mol. Its IUPAC name is tert-butyl N-[1-(3-bromo-5-chloro-4-cyano-2-ethoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[1-(3-bromo-5-chloro-4-cyano-2-ethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 123418761 |
| Molecular Formula | C16H20BrClN2O3 |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | tert-butyl N-[1-(3-bromo-5-chloro-4-cyano-2-ethoxyphenyl)ethyl]carbamate |
| SMILES | CCOc1c(C(C)NC(=O)OC(C)(C)C)cc(Cl)c(C#N)c1Br |
| InChI | InChI=1S/C16H20BrClN2O3/c1-6-22-14-10(7-12(18)11(8-19)13(14)17)9(2)20-15(21)23-16(3,4)5/h7,9H,6H2,1-5H3,(H,20,21) |
| InChIKey | RQECKIXWUUBBST-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |