C18H21ClN2O4 — CID 86697528
tert-butyl N-[2-(6-acetyl-4-chloro-3-cyano-2-ethenylphenoxy)ethyl]carbamate (PubChem CID 86697528) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is tert-butyl N-[2-(6-acetyl-4-chloro-3-cyano-2-ethenylphenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-acetyl-4-chloro-3-cyano-2-ethenylphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 86697528 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | tert-butyl N-[2-(6-acetyl-4-chloro-3-cyano-2-ethenylphenoxy)ethyl]carbamate |
| SMILES | C=Cc1c(C#N)c(Cl)cc(C(C)=O)c1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H21ClN2O4/c1-6-12-14(10-20)15(19)9-13(11(2)22)16(12)24-8-7-21-17(23)25-18(3,4)5/h6,9H,1,7-8H2,2-5H3,(H,21,23) |
| InChIKey | COUPCDORIWBWKP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|