C17H23ClN2O6 — CID 129125128
tert-butyl N-[3-(6-acetyl-4-chloro-3-methyl-2-nitrophenoxy)propyl]carbamate (PubChem CID 129125128) has the molecular formula C17H23ClN2O6 and a molecular weight of 386.83 g/mol. Its IUPAC name is tert-butyl N-[3-(6-acetyl-4-chloro-3-methyl-2-nitrophenoxy)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(6-acetyl-4-chloro-3-methyl-2-nitrophenoxy)propyl]carbamate |
|---|---|
| PubChem CID | 129125128 |
| Molecular Formula | C17H23ClN2O6 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | tert-butyl N-[3-(6-acetyl-4-chloro-3-methyl-2-nitrophenoxy)propyl]carbamate |
| SMILES | CC(=O)c1cc(Cl)c(C)c([N+](=O)[O-])c1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23ClN2O6/c1-10-13(18)9-12(11(2)21)15(14(10)20(23)24)25-8-6-7-19-16(22)26-17(3,4)5/h9H,6-8H2,1-5H3,(H,19,22) |
| InChIKey | NOZBBTAFHCBGBH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|