C19H24N2O2 — CID 143478940
tert-butyl N-[(1R)-1-(3-methyl-4-pyridin-4-ylphenyl)ethyl]carbamate (PubChem CID 143478940) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(3-methyl-4-pyridin-4-ylphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(3-methyl-4-pyridin-4-ylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 143478940 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl N-[(1R)-1-(3-methyl-4-pyridin-4-ylphenyl)ethyl]carbamate |
| SMILES | Cc1cc([C@@H](C)NC(=O)OC(C)(C)C)ccc1-c1ccncc1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-12-16(14(2)21-18(22)23-19(3,4)5)6-7-17(13)15-8-10-20-11-9-15/h6-12,14H,1-5H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | KBJXUXPFLSRQGE-CQSZACIVSA-N |
| XLogP | 4.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |