C26H27N5O2 — CID 78121467
tert-butyl N-[1-[4-[(6-pyridin-4-ylquinazolin-2-yl)amino]phenyl]ethyl]carbamate (PubChem CID 78121467) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(6-pyridin-4-ylquinazolin-2-yl)amino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(6-pyridin-4-ylquinazolin-2-yl)amino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 78121467 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | tert-butyl N-[1-[4-[(6-pyridin-4-ylquinazolin-2-yl)amino]phenyl]ethyl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)c1ccc(Nc2ncc3cc(-c4ccncc4)ccc3n2)cc1 |
| InChI | InChI=1S/C26H27N5O2/c1-17(29-25(32)33-26(2,3)4)18-5-8-22(9-6-18)30-24-28-16-21-15-20(7-10-23(21)31-24)19-11-13-27-14-12-19/h5-17H,1-4H3,(H,29,32)(H,28,30,31) |
| InChIKey | IAEYTQVLWHKMCR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |