C25H28F2N2O3S — CID 118326199
N-[3-[3-(1-ethoxyisoquinoline-5-carbonyl)-2,4-difluorophenyl]propyl]-2-methylpropane-2-sulfinamide (PubChem CID 118326199) has the molecular formula C25H28F2N2O3S and a molecular weight of 474.57 g/mol. Its IUPAC name is N-[3-[3-(1-ethoxyisoquinoline-5-carbonyl)-2,4-difluorophenyl]propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[3-[3-(1-ethoxyisoquinoline-5-carbonyl)-2,4-difluorophenyl]propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118326199 |
| Molecular Formula | C25H28F2N2O3S |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | N-[3-[3-(1-ethoxyisoquinoline-5-carbonyl)-2,4-difluorophenyl]propyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCOc1nccc2c(C(=O)c3c(F)ccc(CCCNS(=O)C(C)(C)C)c3F)cccc12 |
| InChI | InChI=1S/C25H28F2N2O3S/c1-5-32-24-19-10-6-9-18(17(19)13-15-28-24)23(30)21-20(26)12-11-16(22(21)27)8-7-14-29-33(31)25(2,3)4/h6,9-13,15,29H,5,7-8,14H2,1-4H3 |
| InChIKey | NBWWFFZBWJRODM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|