C9H16N4O2 — CID 118329687
(3aR,7aR)-7a-(azidomethyl)-2,2-dimethyl-4,5,6,7-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine (PubChem CID 118329687) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (3aR,7aR)-7a-(azidomethyl)-2,2-dimethyl-4,5,6,7-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine.
| Compound Name | (3aR,7aR)-7a-(azidomethyl)-2,2-dimethyl-4,5,6,7-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 118329687 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (3aR,7aR)-7a-(azidomethyl)-2,2-dimethyl-4,5,6,7-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine |
| SMILES | CC1(C)O[C@@H]2CNCC[C@]2(CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C9H16N4O2/c1-8(2)14-7-5-11-4-3-9(7,15-8)6-12-13-10/h7,11H,3-6H2,1-2H3/t7-,9-/m1/s1 |
| InChIKey | YWKKDNQBEYMCSS-VXNVDRBHSA-N |
| XLogP | 1.18 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|