C34H34Cl2F3N3O5S — CID 118329995
6-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyhexanoic acid (PubChem CID 118329995) has the molecular formula C34H34Cl2F3N3O5S and a molecular weight of 724.63 g/mol. Its IUPAC name is 6-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyhexanoic acid.
| Compound Name | 6-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 118329995 |
| Molecular Formula | C34H34Cl2F3N3O5S |
| Molecular Weight | 724.63 g/mol |
| Exact Mass | 723.15 |
| IUPAC Name | 6-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1cc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C34H34Cl2F3N3O5S/c35-25-10-5-22(6-11-25)33(23-7-12-26(36)13-8-23)24-9-14-29-28(20-24)30(21-31(41-29)47-19-3-1-2-4-32(43)44)40-27-15-17-42(18-16-27)48(45,46)34(37,38)39/h5-14,20-21,27,33H,1-4,15-19H2,(H,40,41)(H,43,44) |
| InChIKey | YLLXEQXOWQTGDY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.63 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|