C30H26Cl2F3N3O5S — CID 118329993
2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyacetic acid (PubChem CID 118329993) has the molecular formula C30H26Cl2F3N3O5S and a molecular weight of 668.52 g/mol. Its IUPAC name is 2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyacetic acid.
| Compound Name | 2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 118329993 |
| Molecular Formula | C30H26Cl2F3N3O5S |
| Molecular Weight | 668.52 g/mol |
| Exact Mass | 667.09 |
| IUPAC Name | 2-[6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-2-yl]oxyacetic acid |
| SMILES | O=C(O)COc1cc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C30H26Cl2F3N3O5S/c31-21-6-1-18(2-7-21)29(19-3-8-22(32)9-4-19)20-5-10-25-24(15-20)26(16-27(37-25)43-17-28(39)40)36-23-11-13-38(14-12-23)44(41,42)30(33,34)35/h1-10,15-16,23,29H,11-14,17H2,(H,36,37)(H,39,40) |
| InChIKey | PIVZSKWUQYYFKC-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|