C32H30Cl2F3N3O4S — CID 118324002
(E)-3-[6-[bis(4-chlorophenyl)methyl]-2-methoxy-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]prop-2-en-1-ol (PubChem CID 118324002) has the molecular formula C32H30Cl2F3N3O4S and a molecular weight of 680.58 g/mol. Its IUPAC name is (E)-3-[6-[bis(4-chlorophenyl)methyl]-2-methoxy-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]prop-2-en-1-ol.
| Compound Name | (E)-3-[6-[bis(4-chlorophenyl)methyl]-2-methoxy-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 118324002 |
| Molecular Formula | C32H30Cl2F3N3O4S |
| Molecular Weight | 680.58 g/mol |
| Exact Mass | 679.13 |
| IUPAC Name | (E)-3-[6-[bis(4-chlorophenyl)methyl]-2-methoxy-4-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]amino]quinolin-8-yl]prop-2-en-1-ol |
| SMILES | COc1cc(NC2CCN(S(=O)(=O)C(F)(F)F)CC2)c2cc(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)cc(/C=C/CO)c2n1 |
| InChI | InChI=1S/C32H30Cl2F3N3O4S/c1-44-29-19-28(38-26-12-14-40(15-13-26)45(42,43)32(35,36)37)27-18-23(17-22(3-2-16-41)31(27)39-29)30(20-4-8-24(33)9-5-20)21-6-10-25(34)11-7-21/h2-11,17-19,26,30,41H,12-16H2,1H3,(H,38,39)/b3-2+ |
| InChIKey | HGAYVJKMHMDCIL-NSCUHMNNSA-N |
| XLogP | 7.46 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.58 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|