C14H15NO9S3 — CID 118330482
5-[aminooxy-(3-methylsulfonylphenyl)methyl]benzene-1,3-disulfonic acid (PubChem CID 118330482) has the molecular formula C14H15NO9S3 and a molecular weight of 437.47 g/mol. Its IUPAC name is 5-[aminooxy-(3-methylsulfonylphenyl)methyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[aminooxy-(3-methylsulfonylphenyl)methyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 118330482 |
| Molecular Formula | C14H15NO9S3 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | 5-[aminooxy-(3-methylsulfonylphenyl)methyl]benzene-1,3-disulfonic acid |
| SMILES | CS(=O)(=O)c1cccc(C(ON)c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C14H15NO9S3/c1-25(16,17)11-4-2-3-9(5-11)14(24-15)10-6-12(26(18,19)20)8-13(7-10)27(21,22)23/h2-8,14H,15H2,1H3,(H,18,19,20)(H,21,22,23) |
| InChIKey | VZJZMOXULSFZCQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|