C14H12Br3NO6S2 — CID 164820158
2-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzenesulfonic acid (PubChem CID 164820158) has the molecular formula C14H12Br3NO6S2 and a molecular weight of 594.10 g/mol. Its IUPAC name is 2-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzenesulfonic acid.
| Compound Name | 2-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 164820158 |
| Molecular Formula | C14H12Br3NO6S2 |
| Molecular Weight | 594.10 g/mol |
| Exact Mass | 590.77 |
| IUPAC Name | 2-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzenesulfonic acid |
| SMILES | NOC(c1cccc(S(=O)(=O)C(Br)(Br)Br)c1)c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C14H12Br3NO6S2/c15-14(16,17)25(19,20)10-5-3-4-9(8-10)13(24-18)11-6-1-2-7-12(11)26(21,22)23/h1-8,13H,18H2,(H,21,22,23) |
| InChIKey | CTPWIBWSZWHZRN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.10 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|