C16H12Br3NO7S — CID 170026179
5-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzene-1,3-dicarboxylic acid (PubChem CID 170026179) has the molecular formula C16H12Br3NO7S and a molecular weight of 602.05 g/mol. Its IUPAC name is 5-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 170026179 |
| Molecular Formula | C16H12Br3NO7S |
| Molecular Weight | 602.05 g/mol |
| Exact Mass | 598.79 |
| IUPAC Name | 5-[aminooxy-[3-(tribromomethylsulfonyl)phenyl]methyl]benzene-1,3-dicarboxylic acid |
| SMILES | NOC(c1cc(C(=O)O)cc(C(=O)O)c1)c1cccc(S(=O)(=O)C(Br)(Br)Br)c1 |
| InChI | InChI=1S/C16H12Br3NO7S/c17-16(18,19)28(25,26)12-3-1-2-8(7-12)13(27-20)9-4-10(14(21)22)6-11(5-9)15(23)24/h1-7,13H,20H2,(H,21,22)(H,23,24) |
| InChIKey | AUOLYABMPATFDF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.05 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|