C16H30N2O5 — CID 118332482
2,2-dimethyl-N-[2-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 118332482) has the molecular formula C16H30N2O5 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[2-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 118332482 |
| Molecular Formula | C16H30N2O5 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2,2-dimethyl-N-[2-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | C=CC(=O)NCCOCCOCCOCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O5/c1-5-14(19)17-6-8-21-10-12-23-13-11-22-9-7-18-15(20)16(2,3)4/h5H,1,6-13H2,2-4H3,(H,17,19)(H,18,20) |
| InChIKey | WJRPFUODAWKRQI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|