About 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine
5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine (PubChem CID 118335569) has the molecular formula C5H5N5
and a molecular weight of 135.13 g/mol. Its IUPAC name is 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine.
Analyze 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine?
The IUPAC name of 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine (CID 118335569) is 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine.
What is the SMILES notation for 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine?
The canonical SMILES for 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine is Cc1ncn2ncnc2n1.
What is the InChIKey of 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine?
The InChIKey is FLZPWIFXNIXFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5/c1-4-7-3-10-5(9-4)6-2-8-10/h2-3H,1H3.
What are the key properties of 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine?
5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine has a molecular weight of 135.13 g/mol, XLogP of -0.17, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine is sourced from PubChem (CID 118335569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).