C17H26N2OSi — CID 11833587
(4S,6S)-3-phenyl-N-prop-2-enyl-6-(trimethylsilylmethyl)-5,6-dihydro-4H-oxazin-4-amine (PubChem CID 11833587) has the molecular formula C17H26N2OSi and a molecular weight of 302.49 g/mol. Its IUPAC name is (4S,6S)-3-phenyl-N-prop-2-enyl-6-(trimethylsilylmethyl)-5,6-dihydro-4H-oxazin-4-amine.
| Compound Name | (4S,6S)-3-phenyl-N-prop-2-enyl-6-(trimethylsilylmethyl)-5,6-dihydro-4H-oxazin-4-amine |
|---|---|
| PubChem CID | 11833587 |
| Molecular Formula | C17H26N2OSi |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (4S,6S)-3-phenyl-N-prop-2-enyl-6-(trimethylsilylmethyl)-5,6-dihydro-4H-oxazin-4-amine |
| SMILES | C=CCN[C@H]1C[C@@H](C[Si](C)(C)C)ON=C1c1ccccc1 |
| InChI | InChI=1S/C17H26N2OSi/c1-5-11-18-16-12-15(13-21(2,3)4)20-19-17(16)14-9-7-6-8-10-14/h5-10,15-16,18H,1,11-13H2,2-4H3/t15-,16-/m0/s1 |
| InChIKey | NJJFGVCTWSJPSC-HOTGVXAUSA-N |
| XLogP | 3.66 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|