C23H20F2N6O2 — CID 118336543
3-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one (PubChem CID 118336543) has the molecular formula C23H20F2N6O2 and a molecular weight of 450.45 g/mol. Its IUPAC name is 3-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one.
| Compound Name | 3-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 118336543 |
| Molecular Formula | C23H20F2N6O2 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3-[8-[(2,6-difluorophenyl)methoxy]-2,6-dimethylimidazo[1,2-a]pyridin-3-yl]-7,7-dimethyl-5H-pyrrolo[2,3-e][1,2,4]triazin-6-one |
| SMILES | Cc1cc(OCc2c(F)cccc2F)c2nc(C)c(-c3nnc4c(n3)NC(=O)C4(C)C)n2c1 |
| InChI | InChI=1S/C23H20F2N6O2/c1-11-8-16(33-10-13-14(24)6-5-7-15(13)25)21-26-12(2)17(31(21)9-11)19-27-20-18(29-30-19)23(3,4)22(32)28-20/h5-9H,10H2,1-4H3,(H,27,28,30,32) |
| InChIKey | DBQVEYFNNIGBOW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |