C19H17N3O — CID 118336920
5-[(1E,3E)-4-(6-methoxyquinolin-2-yl)buta-1,3-dienyl]pyridin-2-amine (PubChem CID 118336920) has the molecular formula C19H17N3O and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-[(1E,3E)-4-(6-methoxyquinolin-2-yl)buta-1,3-dienyl]pyridin-2-amine.
| Compound Name | 5-[(1E,3E)-4-(6-methoxyquinolin-2-yl)buta-1,3-dienyl]pyridin-2-amine |
|---|---|
| PubChem CID | 118336920 |
| Molecular Formula | C19H17N3O |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 5-[(1E,3E)-4-(6-methoxyquinolin-2-yl)buta-1,3-dienyl]pyridin-2-amine |
| SMILES | COc1ccc2nc(/C=C/C=C/c3ccc(N)nc3)ccc2c1 |
| InChI | InChI=1S/C19H17N3O/c1-23-17-9-10-18-15(12-17)7-8-16(22-18)5-3-2-4-14-6-11-19(20)21-13-14/h2-13H,1H3,(H2,20,21)/b4-2+,5-3+ |
| InChIKey | XNERGYPZUUQNEG-ZUVMSYQZSA-N |
| XLogP | 3.95 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|