C18H19N6O+ — CID 143659014
[(E,2Z)-2-(aminomethylidene)-4-(6-amino-3-pyridinyl)-1-(6-methoxy-1H-benzimidazol-2-yl)but-3-enylidene]azanium (PubChem CID 143659014) has the molecular formula C18H19N6O+ and a molecular weight of 335.39 g/mol. Its IUPAC name is [(E,2Z)-2-(aminomethylidene)-4-(6-amino-3-pyridinyl)-1-(6-methoxy-1H-benzimidazol-2-yl)but-3-enylidene]azanium.
| Compound Name | [(E,2Z)-2-(aminomethylidene)-4-(6-amino-3-pyridinyl)-1-(6-methoxy-1H-benzimidazol-2-yl)but-3-enylidene]azanium |
|---|---|
| PubChem CID | 143659014 |
| Molecular Formula | C18H19N6O+ |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [(E,2Z)-2-(aminomethylidene)-4-(6-amino-3-pyridinyl)-1-(6-methoxy-1H-benzimidazol-2-yl)but-3-enylidene]azanium |
| SMILES | COc1ccc2nc(C(=[NH2+])C(=C\N)/C=C/c3ccc(N)nc3)[nH]c2c1 |
| InChI | InChI=1S/C18H18N6O/c1-25-13-5-6-14-15(8-13)24-18(23-14)17(21)12(9-19)4-2-11-3-7-16(20)22-10-11/h2-10,21H,19H2,1H3,(H2,20,22)(H,23,24)/p+1/b4-2+,12-9-,21-17? |
| InChIKey | VFRFBLUCDWLROO-FSHGTRMASA-O |
| XLogP | 0.65 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|